1-(2-Nitro-vinyl)-4-trifluoromethyl-benzene
1-(2-nitroethenyl)-4-(trifluoromethyl)benzene
Also Known As: cefpiramide|4-trifluoromethyl-beta-nitrostyrene|1-(2-Nitro-vinyl)-4-trifluoromethyl-benzene|1-(2-nitrovinyl)-4-(trifluoromethyl)benzene|1-(2-nitroethenyl)-4-(trifluoromethyl)benzene|1-(4-trifluoromethylphenyl)-2-nitroethylene|4-Trifluoromethyl-trans-beta-nitrostyrene|1-(2-nitrovinyl)-4-trifluoromethylbenzene|1-[(E)-2-nitroethenyl]-4-(trifluoromethyl)benzene|(E)-1-(2-nitrovinyl)-4-(trifluoromethyl)benzene|1-trifluoromethyl-4-(2-nitro-vinyl)-benzene
| Molecular Formula | C9H6F3NO2 |
|---|---|
| Molecular Weight | 217.03506 g/mol |
| LogP | 3.2 |
| Topological Polar Surface Area | 45.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Exact Mass | 217.03506 |
| Monoisotopic Mass | 217.03506 |
| Heavy Atoms | 15 |
| Complexity | 249.0 |
Chemical Identifiers
| CAS Number | 99696-01-2 |
|---|---|
| SMILES | C1=CC(=CC=C1C=C[N+](=O)[O-])C(F)(F)F |
| InChIKey | CATQYSSYYQMLHV-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 5 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
1-(2-Nitro-vinyl)-4-trifluoromethyl-benzene (CAS 99696-01-2), with molecular formula C9H6F3NO2 and molecular weight 217.03506 g/mol. IUPAC: 1-(2-nitroethenyl)-4-(trifluoromethyl)benzene.
1-(2-Nitro-vinyl)-4-trifluoromethyl-benzene is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »