1-Naphthyl trifluoromethanesulfonate
naphthalen-1-yl trifluoromethanesulfonate
Also Known As: 1-Naphthyl trifluoromethanesulfonate|1-Naphthyl triflate|naphthalen-1-yl trifluoromethanesulfonate|naphthyl triflate|1-naphthyl-triflate|1-Naphthalenyl triflate|ACMC-20aot0|1-NAPHTHYLTRIFLATE|1-Naphthol trifluoromethanesulfonate|1-(Trifluoromethanesulfonyl)naphthalene|naphthalen-1-yltrifluoromethanesulfonate|1-(Trifluoromethylsulfonyloxy)naphthalene|1-Naphthyl trifluoromethanesulfonate, 97%|Trifluoromethanesulfonic acid 1-naphthalenyl ester|I14-47445|Methanesulfonic acid, 1,1,1-trifluoro-, 1-naphthalenyl ester|623-315-0
| Molecular Formula | C11H7F3O3S |
|---|---|
| Molecular Weight | 276.0068 g/mol |
| LogP | 4.4 |
| Topological Polar Surface Area | 51.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Exact Mass | 276.0068 |
| Monoisotopic Mass | 276.0068 |
| Heavy Atoms | 18 |
| Complexity | 385.0 |
Chemical Identifiers
| CAS Number | 99747-74-7 |
|---|---|
| SMILES | C1=CC=C2C(=C1)C=CC=C2OS(=O)(=O)C(F)(F)F |
| InChIKey | WQWUQDVFRYMMCY-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 9 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
1-Naphthyl trifluoromethanesulfonate (CAS 99747-74-7), with molecular formula C11H7F3O3S and molecular weight 276.0068 g/mol. IUPAC: naphthalen-1-yl trifluoromethanesulfonate.