B 1366
TL;DR: B 1366 (CAS 136996-73-1) is a chemical compound with molecular formula C17H23Cl2N3OS and molecular weight 387.0939 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
5-[2-[4-(2-chloro-6-methylphenyl)piperazin-1-yl]ethoxy]-4-methyl-1,3-thiazole;hydrochloride
Also Known As: B 1366, Piperazine, 1-(2-chloro-6-methylphenyl)-4-(2-((4-methyl-5-thiazolyl)oxy)ethyl)-, monohydrochloride, 4-Methyl-5-(2-(4-(6-chloro-2-methylphenyl)piperazin-1-yl)ethoxy)thiazole hydrochloride, 1-(2-Chloro-6-methylphenyl)-4-{2-[(4-methyl-1,3-thiazol-5-yl)oxy]ethyl}piperazine--hydrogen chloride (1/1), 5-[2-[4-(2-chloro-6-methylphenyl)piperazin-1-yl]ethoxy]-4-methyl-1,3-thiazole hydrochloride
Technical Specifications
| Molecular Formula | C17H23Cl2N3OS |
| Molecular Weight | 387.0939 g/mol |
| XLogP | 4.03614 |
| Topological Polar Surface Area (TPSA) | 56.8 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Exact Mass | 387.0939 Da |
| Heavy Atoms | 24 |
| Complexity | 368.0 |
| SMILES | CC1=C(C(=CC=C1)Cl)N2CCN(CC2)CCOC3=C(N=CS3)C.Cl |
| InChIKey | ZCCMONVTIDKASM-UHFFFAOYSA-N |
Chemical Property Profile of B 1366
Property Insights of B 1366
The XLogP value of 4.03614 indicates that B 1366 is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. With a topological polar surface area (TPSA) of 56.8 Ų, B 1366 exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, B 1366 has 1 hydrogen bond donor(s) and 5 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
What is the CAS number of B 1366?
The CAS number of B 1366 is 136996-73-1.
What is the molecular formula of B 1366?
The molecular formula of B 1366 is C17H23Cl2N3OS.
What is the molecular weight of B 1366?
The molecular weight of B 1366 is 387.0939 g/mol.
Where can I buy B 1366?
You can request a quote for B 1366 directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for B 1366?
Yes, CoreyChem provides custom synthesis services for B 1366 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.