2-Fluorophenylboronic acid
(2-fluorophenyl)boronic acid
Also Known As: 2-Fluorophenylboronic acid|(2-fluorophenyl)boronic acid|2-Fluorobenzeneboronic Acid|null|diethylphosphate|o-fluorophenylboronic acid|(2-fluorophenyl)boranediol|Boronic acid, B-(2-fluorophenyl)-|2-Fluorophenylboronicacid|2-fluorophenyl boronic acid|Phenylboronic Acid, 14|Vonoprazan Impurity 215|2-Fluorophenylboranic acid|ACMC-1BR1I|o-fluorobenzeneboronic acid|o -Fluorophenylboronic acid|(2-fluorophenyl)boronicacid|2-?Fluorophenylboronic acid|2-fluoro phenylboronic acid|2-fluoro-phenylboronic acid|2-Fluorophenyl-boronic acid|2-fluoro benzeneboronic acid|2-fluorobenzene boronic acid|2-fluorobenzene-boronic acid|2-fluoro -phenylboronic acid|2-fluoro phenyl boronic acid|2-fluoro-phenyl boronic acid|2-fluoro-phenyl-boronic acid|(2-fluorophenyl) boronic acid|(2-Fluorophenyl)boronato(2-)|dihydroxy(2-fluorophenyl)borane|B-(2-Fluorophenyl)boronic acid|BORONIC ACID, (2-FLUOROPHENYL)-|O-FLUORO-BENZENEBORONIC ACID|KS-00003GRY
| Molecular Formula | C6H6BFO2 |
|---|---|
| Molecular Weight | 140.0445 g/mol |
| LogP | -0.4945 |
| Topological Polar Surface Area | 40.46 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Exact Mass | 140.0445 |
| Monoisotopic Mass | 140.0445 |
| Heavy Atoms | 10 |
| Complexity | 226.74274 |
Chemical Identifiers
| CAS Number | 34-03-7 |
|---|---|
| SMILES | B(C1=CC=CC=C1F)(O)O |
Product Overview
2-Fluorophenylboronic acid (CAS 34-03-7), with molecular formula C6H6BFO2 and molecular weight 140.0445 g/mol. IUPAC: (2-fluorophenyl)boronic acid.