bisabolol oxide B
TL;DR: bisabolol oxide B (CAS 55399-12-7) is a chemical compound with molecular formula C15H26O2 and molecular weight 238.19328 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
2-[5-methyl-5-(4-methylcyclohex-3-en-1-yl)oxolan-2-yl]propan-2-ol
Also Known As: Bisabolol oxide B, Bisabololoxide B, bisabololoxid B, Bisabolol oxide II, alpha-Bisabolol oxide B
Application Areas
Top 5 of 1 IPC patent classification(s) from the SureChEMBL global patent database.
Technical Specifications
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.19328 g/mol |
| XLogP | 2.5 |
| Topological Polar Surface Area (TPSA) | 29.5 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 238.19328 Da |
| Heavy Atoms | 17 |
| Complexity | 319.0 |
| SMILES | CC1=CCC(CC1)C2(CCC(O2)C(C)(C)O)C |
| InChIKey | RKBAYVATPNYHLW-UHFFFAOYSA-N |
Chemical Property Profile of bisabolol oxide B
Property Insights of bisabolol oxide B
The XLogP value of 2.5 suggests moderate lipophilicity, balancing water solubility and membrane permeability for bisabolol oxide B. With a topological polar surface area (TPSA) of 29.5 Ų, bisabolol oxide B exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, bisabolol oxide B has 1 hydrogen bond donor(s) and 2 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
What is the CAS number of bisabolol oxide B?
The CAS number of bisabolol oxide B is 55399-12-7.
What is the molecular formula of bisabolol oxide B?
The molecular formula of bisabolol oxide B is C15H26O2.
What is the molecular weight of bisabolol oxide B?
The molecular weight of bisabolol oxide B is 238.19328 g/mol.
Where can I buy bisabolol oxide B?
You can request a quote for bisabolol oxide B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for bisabolol oxide B?
Yes, CoreyChem provides custom synthesis services for bisabolol oxide B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.