(2Z)-3-hydroxy-2-phenylprop-2-enenitrile
(Z)-3-hydroxy-2-phenylprop-2-enenitrile
Also Known As: (2Z)-3-hydroxy-2-phenylprop-2-enenitrile|2-cyano-2-phenylacetaldehyde|(2Z)-3-Hydroxy-2-phenylacrylonitrile|3-Hydroxy-2-phenylacrylonitrile|EINECS 244-871-7|(Z)-3-hydroxy-2-phenylacrylonitrile|2-CYANO-2-PHENYLVINYLALCOHOL|3-hydroxy-2-phenylprop-2-enenitrile|7615AD|(Z)-2-Phenyl-3-hydroxypropenenitrile|(Z)-3-hydroxy-2-phenyl-2-propenenitrile|(Z)-3-hydroxy-2-phenylprop-2-enenitrile|alpha-(Hydroxymethylene)benzeneacetonitrile|(2Z)-3-hydroxy-2-phenyl-2-propenenitrile|(Z)-3-hydroxy-2-phenyl-prop-2-enenitrile|2G-025
| Molecular Formula | C9H7NO |
|---|---|
| Molecular Weight | 145.05276 g/mol |
| LogP | 2.10908 |
| Topological Polar Surface Area | 44.02 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Exact Mass | 145.05276 |
| Monoisotopic Mass | 145.05276 |
| Heavy Atoms | 11 |
| Complexity | 295.0888 |
Chemical Identifiers
| CAS Number | 5841-70-3 |
|---|---|
| SMILES | C1=CC=C(C=C1)/C(=C/O)/C#N |
Product Overview
(2Z)-3-hydroxy-2-phenylprop-2-enenitrile (CAS 5841-70-3), with molecular formula C9H7NO and molecular weight 145.05276 g/mol. IUPAC: (Z)-3-hydroxy-2-phenylprop-2-enenitrile.
(2Z)-3-hydroxy-2-phenylprop-2-enenitrile is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »