Cyclohexanone, 2,6-bis[[4-(dimethylamino)phenyl]methylene]-4-methyl-
2,6-bis[[4-(dimethylamino)phenyl]methylidene]-4-methylcyclohexan-1-one
Also Known As: UPCMLD0ENAT0500-0296:001|Cyclohexanone, 2,6-bis[[4-(dimethylamino)phenyl]methylene]-4-methyl-|1-Methyl-3.5-bis-(4-dimethylamino-benzal)-cyclohexanon-(4)|2,6-bis[(4-dimethylaminophenyl)methylidene]-4-methylcyclohexan-1-one|2,6-bis[[4-(dimethylamino)phenyl]methylidene]-4-methylcyclohexan-1-one|2,6-Bis{[4-(dimethylamino)phenyl]methylidene}-4-methylcyclohexan-1-one
| Molecular Formula | C25H30N2O |
|---|---|
| Molecular Weight | 374.2358 g/mol |
| LogP | 5.2846 |
| Topological Polar Surface Area | 23.55 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 374.2358 |
| Monoisotopic Mass | 374.2358 |
| Heavy Atoms | 28 |
| Complexity | 813.65 |
Chemical Identifiers
| CAS Number | 65446-46-0 |
|---|---|
| SMILES | CC1CC(=CC2=CC=C(C=C2)N(C)C)C(=O)C(=CC3=CC=C(C=C3)N(C)C)C1 |
Product Overview
Cyclohexanone, 2,6-bis[[4-(dimethylamino)phenyl]methylene]-4-methyl- (CAS 65446-46-0), with molecular formula C25H30N2O and molecular weight 374.2358 g/mol. IUPAC: 2,6-bis[[4-(dimethylamino)phenyl]methylidene]-4-methylcyclohexan-1-one.
Cyclohexanone, 2,6-bis[[4-(dimethylamino)phenyl]methylene]-4-methyl- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »