Quinoline, 2,8-dimethyl-4-(p-(4-(o-tolyl)-1-piperazinyl)anilino)-
2,8-dimethyl-N-[4-[4-(2-methylphenyl)piperazin-1-yl]phenyl]quinolin-4-amine
Also Known As: Quinoline, 2,8-dimethyl-4-(p-(4-(o-tolyl)-1-piperazinyl)anilino)-|2,8-Dimethyl-4-(p-(4-(o-tolyl)-1-piperazinyl)anilino)quinoline|4-Quinolinamine, 2,8-dimethyl-N-(4-(4-(2-methylphenyl)-1-piperazinyl)phenyl)-|2,8-dimethyl-N-[4-[4-(2-methylphenyl)piperazin-1-yl]phenyl]quinolin-4-amine|2,8-Dimethyl-N-{4-[4-(2-methylphenyl)piperazin-1-yl]phenyl}quinolin-4-amine
| Molecular Formula | C28H30N4 |
|---|---|
| Molecular Weight | 422.24704 g/mol |
| LogP | 6.23026 |
| Topological Polar Surface Area | 31.4 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Exact Mass | 422.24704 |
| Monoisotopic Mass | 422.24704 |
| Heavy Atoms | 32 |
| Complexity | 1238.2548 |
Chemical Identifiers
| CAS Number | 87602-50-4 |
|---|---|
| SMILES | CC1=C2C(=CC=C1)C(=CC(=N2)C)NC3=CC=C(C=C3)N4CCN(CC4)C5=CC=CC=C5C |
Product Overview
Quinoline, 2,8-dimethyl-4-(p-(4-(o-tolyl)-1-piperazinyl)anilino)- (CAS 87602-50-4), with molecular formula C28H30N4 and molecular weight 422.24704 g/mol. IUPAC: 2,8-dimethyl-N-[4-[4-(2-methylphenyl)piperazin-1-yl]phenyl]quinolin-4-amine.
Quinoline, 2,8-dimethyl-4-(p-(4-(o-tolyl)-1-piperazinyl)anilino)- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »